CymitQuimica logo

CAS 98651-71-9

:

N-(2,4-Difluorophenyl)-2,2,2-trifluoroacetamide

Description:
N-(2,4-Difluorophenyl)-2,2,2-trifluoroacetamide is a chemical compound characterized by its unique structure, which includes a difluorophenyl group and a trifluoroacetamide moiety. This compound features a phenyl ring substituted with two fluorine atoms at the 2 and 4 positions, contributing to its lipophilicity and potential biological activity. The trifluoroacetamide functional group enhances its stability and reactivity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The presence of multiple fluorine atoms typically imparts unique properties such as increased metabolic stability and altered solubility profiles. This compound is likely to exhibit specific interactions with biological targets, which can be explored for therapeutic purposes. Additionally, its synthesis and handling require careful consideration due to the presence of fluorinated groups, which can influence its environmental persistence and toxicity. Overall, N-(2,4-Difluorophenyl)-2,2,2-trifluoroacetamide represents a class of fluorinated compounds that are valuable in both research and industrial applications.
Formula:C8H4F5NO
InChI:InChI=1S/C8H4F5NO/c9-4-1-2-6(5(10)3-4)14-7(15)8(11,12)13/h1-3H,(H,14,15)
InChI key:InChIKey=KFBSEUVNGYXFLB-UHFFFAOYSA-N
SMILES:N(C(C(F)(F)F)=O)C1=C(F)C=C(F)C=C1
Synonyms:
  • N-(2,4-Difluorophenyl)-2,2,2-trifluoroacetamide
  • Acetamide, N-(2,4-difluorophenyl)-2,2,2-trifluoro-
Found 4 products.