CymitQuimica logo

CAS 98661-43-9

:

2-(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)propane-1,3-diol

Description:
2-(6,7-Diethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)propane-1,3-diol, with the CAS number 98661-43-9, is a chemical compound that features a complex structure characterized by a tetrahydroisoquinoline moiety. This compound typically exhibits properties associated with both its isoquinoline core and the diol functional groups. The presence of diethoxy groups suggests that it may have enhanced solubility in organic solvents and could participate in various chemical reactions, including nucleophilic substitutions. The propane-1,3-diol component indicates the presence of hydroxyl groups, which can engage in hydrogen bonding, potentially influencing its physical properties such as melting and boiling points, as well as its reactivity. Additionally, the compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry. However, specific characteristics such as solubility, stability, and reactivity would depend on the conditions under which the compound is studied. As with many organic compounds, safety data and handling precautions should be considered when working with this substance.
Formula:C16H25NO4
InChI:InChI=1/C16H25NO4/c1-3-20-14-7-11-5-6-17-16(12(9-18)10-19)13(11)8-15(14)21-4-2/h7-8,12,16-19H,3-6,9-10H2,1-2H3
SMILES:CCOc1cc2CCNC(C(CO)CO)c2cc1OCC
Found 1 products.