CAS 98665-16-8
:Lucidenic acid D
Description:
Lucidenic acid D, with the CAS number 98665-16-8, is a triterpenoid compound primarily derived from the medicinal mushroom Ganoderma lucidum, commonly known as reishi. This compound is characterized by its complex tetracyclic structure, which contributes to its biological activity. Lucidenic acid D exhibits various pharmacological properties, including anti-inflammatory, antioxidant, and potential anticancer effects, making it of interest in both traditional medicine and modern pharmacology. Its mechanism of action is thought to involve modulation of various signaling pathways, which may lead to enhanced immune response and reduced oxidative stress. Additionally, lucidenic acid D is known for its ability to interact with specific receptors in the body, further influencing physiological processes. Research into this compound continues to explore its therapeutic potential and safety profile, as well as its role in promoting overall health. As with many natural products, the extraction and purification processes are crucial for obtaining lucidenic acid D in a form suitable for scientific study and potential clinical applications.
Formula:C29H38O8
InChI:InChI=1S/C29H38O8/c1-14(8-9-21(34)35)16-12-20(33)29(7)22-17(31)13-18-26(3,4)19(32)10-11-27(18,5)23(22)24(36)25(28(16,29)6)37-15(2)30/h14,16,18,25H,8-13H2,1-7H3,(H,34,35)/t14-,16-,18+,25-,27+,28+,29+/m1/s1
InChI key:InChIKey=LTJSBYAKDOGXLX-JTJCPSTFSA-N
SMILES:C[C@@]12[C@](C)(C3=C(C(=O)[C@H]1OC(C)=O)[C@]4(C)[C@@](CC3=O)(C(C)(C)C(=O)CC4)[H])C(=O)C[C@@]2([C@@H](CCC(O)=O)C)[H]
Synonyms:- Lucidenic acid D
- (5α,12β)-12-(Acetyloxy)-4,4,14-trimethyl-3,7,11,15-tetraoxochol-8-en-24-oic acid
- Lucidenic acid D 2
- Chol-8-en-24-oic acid, 12-(acetyloxy)-4,4,14-trimethyl-3,7,11,15-tetraoxo-, (5α,12β)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Lucidenic acid D
CAS:Lucidenic acid D2 is a nartural product from G. lucidum AF.Formula:C29H38O8Purity:98%Color and Shape:SolidMolecular weight:514.61Lucidenic acid D
CAS:Controlled ProductLucidenic acid D is a reactive molecule that is found in the fungus Ganoderma lucidum. It has shown to inhibit the growth of cancer cells by binding to DNA and inhibiting the synthesis of RNA and protein, which are required for cell division. Lucidenic acid D also inhibits bacterial growth by binding to their DNA and inhibiting transcription. This compound has a low toxicity level, with no adverse effects on human macrophages or kidney function. The chemical structure of lucidenic acid D is closely related to lanostane and urea nitrogen, both of which have been used as chemotherapeutic agents against cancer.
Formula:C29H38O8Purity:Min. 95%Color and Shape:White PowderMolecular weight:514.61 g/mol





