CAS 98665-20-4
:(3beta,7beta,20xi)-3,7,20-trihydroxy-11,15,23-trioxolanost-8-en-26-oic acid
Description:
The chemical substance known as (3beta,7beta,20xi)-3,7,20-trihydroxy-11,15,23-trioxolanost-8-en-26-oic acid, with the CAS number 98665-20-4, is a complex organic compound characterized by multiple hydroxyl groups and a trioxolane structure. This compound belongs to the class of steroid derivatives, which typically exhibit a four-ring core structure. The presence of hydroxyl groups at the 3, 7, and 20 positions suggests potential for significant biological activity, as hydroxylation can influence solubility, reactivity, and interaction with biological targets. The trioxolane moiety may impart unique properties, potentially enhancing its reactivity or stability under certain conditions. Such compounds are often studied for their pharmacological properties, including anti-inflammatory or antimicrobial effects. Additionally, the specific stereochemistry indicated by the nomenclature suggests that the compound may exhibit stereospecific interactions in biological systems. Overall, this substance represents a fascinating area of study within medicinal chemistry and biochemistry, with implications for drug development and therapeutic applications.
Formula:C30H44O8
InChI:InChI=1/C30H44O8/c1-15(25(36)37)10-16(31)13-29(6,38)20-12-22(35)30(7)24-17(32)11-19-26(2,3)21(34)8-9-27(19,4)23(24)18(33)14-28(20,30)5/h15,17,19-21,32,34,38H,8-14H2,1-7H3,(H,36,37)/t15?,17-,19-,20-,21-,27-,28+,29?,30-/m0/s1
InChI key:InChIKey=ZWMMEKXOLCCKLA-OCYWOBKISA-N
SMILES:C[C@]12C3=C([C@]4(C)[C@@](C[C@@H]3O)(C(C)(C)[C@@H](O)CC4)[H])C(=O)C[C@]1(C)[C@]([C@@](CC(C[C@H](C(O)=O)C)=O)(C)O)(CC2=O)[H]
Synonyms:- Lanost-8-en-26-oic acid, 3,7,20-trihydroxy-11,15,23-trioxo-, (3β,7β,25R)-
- Ganoderic acid I
- (3β,7β,25R)-3,7,20-Trihydroxy-11,15,23-trioxolanost-8-en-26-oic acid
- 6-[(3S,5R,7S,10S,13R,14R,17S)-3,7-dihydroxy-4,4,10,13,14-pentamethyl-11,15-dioxo-2,3,5,6,7,12,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-hydroxy-2-methyl-4-oxoheptanoic acid
- (20ξ)-3β,7β,20-Trihydroxy-11,15,23-trioxo-5α-lanost-8-en-26-oic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Ganoderic acid I
CAS:Controlled ProductGanoderic acid I is a chemical compound that belongs to the group of carbonyl compounds. It was first isolated from the mushroom Ganoderma lucidum in 1992. The compound has been shown to interact with the fatty acids and fatty alcohols found in the cell membrane, which leads to lipid peroxidation, cytotoxicity and apoptosis. This process may be due to its ability to form reactive oxygen species and/or its ability to bind with proteins on the surface of cells. Ganoderic acid I has also been reported as having anti-inflammatory properties, which are most likely due to its inhibition of prostaglandin synthesis.Purity:Min. 95%



