CymitQuimica logo

CAS 98730-78-0

:

1-(Bromomethyl)cyclopropanecarbonitrile

Description:
1-(Bromomethyl)cyclopropanecarbonitrile is an organic compound characterized by its unique structure, which includes a cyclopropane ring, a bromomethyl group, and a nitrile functional group. The presence of the bromomethyl group introduces a halogen, which can enhance reactivity, particularly in nucleophilic substitution reactions. The nitrile group (-C≡N) contributes to the compound's polarity and can participate in various chemical reactions, such as hydrolysis or reduction. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is important in synthetic organic chemistry, often serving as an intermediate in the synthesis of more complex molecules. Due to the presence of both bromine and the nitrile group, it may exhibit specific properties such as increased boiling point and reactivity compared to similar compounds without these functional groups. Safety precautions should be taken when handling this compound, as it may be toxic or harmful upon exposure.
Formula:C5H6BrN
InChI:InChI=1S/C5H6BrN/c6-3-5(4-7)1-2-5/h1-3H2
InChI key:InChIKey=XWUVFNLWVDQBRJ-UHFFFAOYSA-N
SMILES:C(Br)C1(C#N)CC1
Synonyms:
  • 1-(Bromomethyl)cyclopropanecarbonitrile
  • 1-(Bromomethyl)cyclopropane-1-carbonitrile
  • Cyclopropanecarbonitrile, 1-(bromomethyl)-
Found 4 products.