CAS 98774-23-3
:Tesmilifene
Description:
Tesmilifene is a synthetic compound that belongs to the class of phenothiazine derivatives. It is primarily recognized for its potential use in cancer therapy, particularly as an adjunct treatment in various malignancies. The compound exhibits a unique mechanism of action, which involves the modulation of multiple signaling pathways, potentially enhancing the efficacy of conventional chemotherapeutic agents. Tesmilifene has been studied for its ability to overcome drug resistance in cancer cells, making it a subject of interest in oncological research. In terms of its chemical properties, Tesmilifene is characterized by its specific molecular structure, which contributes to its biological activity. The compound is typically administered in a clinical setting, and its pharmacokinetics and safety profile are subjects of ongoing investigation. As with many investigational drugs, further studies are necessary to fully elucidate its therapeutic potential and to establish optimal dosing regimens. Overall, Tesmilifene represents a promising avenue in the search for more effective cancer treatments.
Formula:C19H25NO
InChI:InChI=1S/C19H25NO/c1-3-20(4-2)14-15-21-19-12-10-18(11-13-19)16-17-8-6-5-7-9-17/h5-13H,3-4,14-16H2,1-2H3
InChI key:InChIKey=NFIXBCVWIPOYCD-UHFFFAOYSA-N
SMILES:C(C1=CC=C(OCCN(CC)CC)C=C1)C2=CC=CC=C2
Synonyms:- 2-(4-Benzylphenoxy)-N,N-diethylethanamine
- 2-(4-benzylphenoxy)-N,N-diethyl-ethanamine
- Ethanamine, N,N-diethyl-2-[4-(phenylmethyl)phenoxy]-
- N,N-Diethyl-2-(4-benzylphenoxy)ethanamine
- N,N-Diethyl-2-(p-benzylphenoxy)ethylamine
- N,N-Diethyl-2-[4-(phenylmethyl)phenoxy]ethanamine
- Triethylamine, 2-(α-phenyl-p-tolyloxy)-
- DPPE
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-(4-Benzylphenoxy)-N,N-diethylethanamine
CAS:Controlled Product2-(4-Benzylphenoxy)-N,N-diethylethanamine is a chiral compound that has been shown to be an iron chelator. It binds to the ferrous ion in a protonated form, which prevents it from catalyzing hydroxyl radical production. 2-(4-Benzylphenoxy)-N,N-diethylethanamine has been shown to bind to the cell nuclei of rat liver cells and inhibit cholesterol ester transfer, which may be due to its ability to bind with the redox potentials of the cell nuclei. This chemical has also been shown to have light emitting properties, which can be used for structural analysis. The synthesis of 2-(4-benzylphenoxy)-N,N-diethylethanamine includes a two step process: first an asymmetric synthesis of methyl 4-benzylphenylacetate followed by reaction with diethylamine. 2-(4-benzFormula:C19H25NOPurity:Min. 95%Molecular weight:283.41 g/mol

