CymitQuimica logo

CAS 98792-02-0

:

4-chloro-5H-pyrimido[5,4-b]indole

Description:
4-Chloro-5H-pyrimido[5,4-b]indole is a heterocyclic compound characterized by its fused pyrimidine and indole structures, which contribute to its unique chemical properties. This compound features a chlorine atom at the 4-position of the pyrimidine ring, influencing its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of both nitrogen and chlorine atoms in its structure can impart interesting electronic properties, making it a candidate for various applications in medicinal chemistry and material science. Additionally, compounds of this type may exhibit fluorescence or other photophysical properties, which can be useful in imaging or sensing applications. Its synthesis and characterization often involve standard organic chemistry techniques, and it may serve as a building block for more complex molecules in drug development or as a research tool in biochemical studies. As with many heterocycles, its biological activity and potential toxicity should be evaluated in the context of specific applications.
Formula:C10H6ClN3
InChI:InChI=1/C10H6ClN3/c11-10-9-8(12-5-13-10)6-3-1-2-4-7(6)14-9/h1-5,14H
InChI key:RDAAOOPSZHGKFQ-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)c1c(c(Cl)ncn1)[nH]2
Synonyms:
  • 5H-Pyrimido[5,4-b]indole, 4-chloro-
  • 4-Chloro-5H-pyrimido[5,4-b]indole
Found 3 products.