CymitQuimica logo

CAS 98808-50-5

:

Benzoic acid, 2-[[(4-bromophenyl)methyl]thio]-

Description:
Benzoic acid, 2-[[(4-bromophenyl)methyl]thio]- (CAS 98808-50-5) is an organic compound characterized by its benzoic acid backbone, which features a thioether functional group attached to a 4-bromobenzyl moiety. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, including moderate solubility in organic solvents and limited solubility in water due to its hydrophobic aromatic structure. The presence of the bromine atom enhances its reactivity and may influence its biological activity, making it of interest in various chemical and pharmaceutical applications. The thioether group contributes to its unique chemical behavior, potentially affecting its interactions with other molecules. As with many benzoic acid derivatives, it may exhibit antimicrobial properties, making it relevant in food preservation and medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and environmental impact.
Formula:C14H11BrO2S
InChI:InChI=1S/C14H11BrO2S/c15-11-7-5-10(6-8-11)9-18-13-4-2-1-3-12(13)14(16)17/h1-8H,9H2,(H,16,17)
InChI key:ITEYFCUZWSWOKH-UHFFFAOYSA-N
SMILES:C1=CC=C(C(=C1)C(=O)O)SCC2=CC=C(C=C2)Br
Found 4 products.