CymitQuimica logo

CAS 98854-91-2

:

Z-D-a-vinyl-Gly-OMe

Description:
Z-D-a-vinyl-Gly-OMe, with the CAS number 98854-91-2, is a synthetic compound that belongs to the class of amino acid derivatives. It features a vinyl group, which contributes to its reactivity, particularly in polymerization and other organic synthesis reactions. The "Z" designation indicates that it is a protected form of the amino acid glycine, where the amino group is typically protected by a benzyloxycarbonyl (Z) group. The "OMe" indicates the presence of a methoxy group, which can influence the compound's solubility and reactivity. This compound is often utilized in peptide synthesis and as an intermediate in the production of more complex molecules. Its characteristics include moderate stability under standard conditions, but it may be sensitive to strong acids or bases, which can lead to the cleavage of protective groups. Overall, Z-D-a-vinyl-Gly-OMe is a valuable building block in organic chemistry and biochemistry, particularly in the development of peptide-based therapeutics.
Formula:C13H15NO4
InChI:InChI=1S/C13H15NO4/c1-3-11(12(15)17-2)14-13(16)18-9-10-7-5-4-6-8-10/h3-8,11H,1,9H2,2H3,(H,14,16)/t11-/m1/s1
InChI key:YDGRSOXTMWVLOJ-LLVKDONJSA-N
SMILES:COC(=O)[C@@H](C=C)NC(=O)OCC1=CC=CC=C1
Found 2 products.