CAS 98891-36-2
:5-Hexynoic acid, 2-amino-, (2S)-
Description:
5-Hexynoic acid, 2-amino-, (2S)-, with the CAS number 98891-36-2, is an amino acid derivative characterized by its unique structure, which includes both an alkyne functional group and a carboxylic acid group. This compound features a six-carbon chain with a triple bond between the fifth and sixth carbon atoms, along with an amino group attached to the second carbon, indicating its classification as an amino acid. The (2S) designation refers to the specific stereochemistry of the amino group, indicating that it has a particular spatial arrangement that is important for its biological activity. This compound is likely to exhibit properties typical of both amino acids and alkyne-containing compounds, such as potential reactivity in organic synthesis and biological interactions. Its solubility in polar solvents and potential for forming hydrogen bonds due to the carboxylic acid and amino groups may also influence its behavior in various chemical environments. Overall, 5-Hexynoic acid, 2-amino-, (2S)- is of interest in both synthetic organic chemistry and biochemistry.
Formula:C6H9NO2
InChI:InChI=1S/C6H9NO2/c1-2-3-4-5(7)6(8)9/h1,5H,3-4,7H2,(H,8,9)/t5-/m0/s1
InChI key:SCGJGNWMYSYORS-YFKPBYRVSA-N
SMILES:C#CCC[C@@H](C(=O)O)N
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
(S)-2-Aminohex-5-ynoic acid
CAS:Formula:C6H9NO2Purity:99%Color and Shape:SolidMolecular weight:127.1412L-homopropargylglycine
CAS:L-homopropargylglycineFormula:C6H9NO2Purity:98%Color and Shape:Solid-PowderMolecular weight:127.14116L-Homopropargylglycine
CAS:L-Homopropargylglycine is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1].Formula:C6H9NO2Purity:98% - 99.92%Color and Shape:SolidMolecular weight:127.14L-Homopropargylglycine
CAS:L-Homopropargylglycine is a small molecule that inhibits the activity of enzymes involved in fatty acid synthesis. It has been shown to inhibit the activity of enzymes involved in mitochondrial membrane potential and reactive oxygen species production, as well as collagen degradation. L-Homopropargylglycine is used to study the molecular mechanisms of lipid metabolism and mitochondrial function, as well as for wastewater treatment. L-Homopropargylglycine has also been studied as a potential drug for the treatment of metabolic syndrome, diabetes, and cancer.Formula:C6H9NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:127.14 g/molL-Homopropargylglycine
CAS:Controlled ProductStability Hygroscopic
Applications L-homopropargylglycine (cas# 98891-36-2) is a useful research chemical.Formula:C6H9NO2Color and Shape:NeatMolecular weight:127.14






