CAS 98891-41-9
:Pseudolaric acid B beta-D-glucoside
Description:
Pseudolaric acid B beta-D-glucoside is a natural compound derived from the bark of the Pseudolarix amabilis tree, commonly known as the golden larch. This compound is a glycoside, which means it consists of a sugar moiety (in this case, beta-D-glucose) linked to a non-sugar component, pseudolaric acid B. It exhibits various biological activities, including anti-inflammatory and anti-tumor properties, making it of interest in pharmacological research. The structure of pseudolaric acid B beta-D-glucoside features a complex arrangement that contributes to its biological efficacy. It is typically studied for its potential therapeutic applications, particularly in the context of cancer treatment and other diseases. Additionally, its solubility and stability in different solvents can vary, influencing its bioavailability and effectiveness in biological systems. As with many natural products, further research is necessary to fully elucidate its mechanisms of action and potential uses in medicine.
Formula:C29H38O13
InChI:InChI=1S/C29H38O13/c1-15(23(35)40-25-22(34)21(33)20(32)18(14-30)39-25)6-5-10-27(3)19-9-12-28(26(37)42-27)11-7-17(24(36)38-4)8-13-29(19,28)41-16(2)31/h5-7,10,18-22,25,30,32-34H,8-9,11-14H2,1-4H3/b10-5+,15-6+/t18-,19+,20-,21+,22-,25+,27-,28-,29+/m1/s1
InChI key:UUDZDKPKXAEKLA-YHLOYHKPSA-N
SMILES:C/C(=C\C=C\[C@@]1([C@@H]2CC[C@@]3([C@@]2(CCC(=CC3)C(=O)OC)OC(=O)C)C(=O)O1)C)/C(=O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O
Synonyms:- Pseudolaric acid B-O-beta-D-glucopyranoside
- β-D-Glucopyranose, 1-[(2E,4E)-5-[(3R,4S,4aS,9aR)-4a-(acetyloxy)-3,4,4a,5,6,9-hexahydro-7-(methoxycarbonyl)-3-methyl-1-oxo-1H-4,9a-ethanocyclohepta[c]pyran-3-yl]-2-methyl-2,4-pentadienoate]
- Pseudolaric acid B-O-β-D- glucopyranoside
- Pseudolaric acid B-glucopyranoside
- Pseudolaric acid B beta-D-glucoside
- Pseudolaric acid B β-D-glucoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Ref: IN-DA01DDE8
1mg72.00€5mg131.00€10mg169.00€20mg169.00€50mg238.00€100mg525.00€200mg629.00€500mg1,255.00€Pseudolaric acid B β-D-glucoside
CAS:Pseudolaric acid B β-D-glucosideFormula:C29H38O13Purity:≥95%Molecular weight:594.6Pseudolaric acid B β-D-glucoside
CAS:Pseudolaric acid B β-D-glucoside (Pseudolaric acid B-glucopyranoside) is a natural product from Pseudolarix amabilis.Formula:C29H38O13Purity:98.55% - ≥95%Color and Shape:SolidMolecular weight:594.60Pseudolaric acid B-glucopyranoside
CAS:Natural glycosideFormula:C29H38O13Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:594.61Pseudolaric acid B-O-beta-D-glucopyranoside
CAS:Pseudolaric acid B-O-beta-D-glucopyranoside is a secondary metabolite, which is a bioactive compound sourced from the bark of the Pseudolarix amabilis, a coniferous tree native to China. It exhibits its mode of action primarily through the disruption of fungal cell integrity and inhibition of fungal growth by interfering with the synthesis of key structural components in the cell wall. This action makes it a potent antifungal agent with secondary antibacterial properties.Purity:Min. 95%







