CAS 98892-75-2
:1-Butyl-2,3-dimethylimidazolium chloride
Description:
1-Butyl-2,3-dimethylimidazolium chloride is an ionic liquid, characterized by its low volatility and high thermal stability. It features a cation derived from imidazole, specifically a butyl group attached to the nitrogen atom, along with two methyl groups on the 2 and 3 positions of the imidazole ring. The chloride anion complements the cation, contributing to the ionic nature of the substance. This compound is typically colorless to pale yellow and exhibits a relatively low melting point, allowing it to remain in a liquid state at room temperature. Its unique properties make it an excellent solvent for various chemical reactions, particularly in organic synthesis and electrochemistry. Additionally, it has applications in catalysis, extraction processes, and as a medium for biomass processing. The presence of the butyl group enhances its solubility in organic solvents, while the imidazolium structure contributes to its stability and ionic conductivity. Overall, 1-butyl-2,3-dimethylimidazolium chloride is a versatile compound with significant potential in green chemistry and material science.
Formula:C9H17N2
InChI:InChI=1/C9H17N2/c1-4-5-6-11-8-7-10(3)9(11)2/h7-8H,4-6H2,1-3H3/q+1
SMILES:CCCCN1C=CN(C)C1C
Synonyms:- 1-butyl-2,3-dimethyl-1H-imidazol-3-ium chloride
- 1-butyl-2,3-dimethyl-1H-imidazol-3-ium
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Butyl-2,3-dimethylimidazolium Chloride
CAS:Formula:C9H17ClN2Purity:>98.0%(T)(HPLC)Color and Shape:White - Yellow Solid FormMolecular weight:188.701-Butyl-2,3-dimethylimidazolium chloride, 99%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H17N2Purity:99%Color and Shape:White to pale cream, Crystals or powder or crystalline powderMolecular weight:153.251-butyl-2,3-dimethyl-1H-imidazol-3-ium chloride
CAS:Formula:C9H17ClN2Purity:98%Color and Shape:SolidMolecular weight:188.69771-Butyl-2,3-dimethyl-1H-imidazol-3-ium chloride
CAS:1-Butyl-2,3-dimethyl-1H-imidazol-3-ium chlorideFormula:C9H17ClN2Purity:99%Color and Shape:SolidMolecular weight:188.71-Butyl-2,3-dimethyl-1H-imidazol-3-ium chloride
CAS:Formula:C9H17ClN2Purity:98%Color and Shape:Liquid, No data available.Molecular weight:188.7




