CymitQuimica logo

CAS 98892-76-3

:

1-Ethyl-2,3-dimethylimidazolium bromide

Description:
1-Ethyl-2,3-dimethylimidazolium bromide is an ionic liquid that belongs to the family of imidazolium-based salts. It is characterized by its low volatility, high thermal stability, and ability to dissolve a wide range of organic and inorganic compounds, making it useful in various applications such as solvents, electrolytes, and catalysts. The presence of the ethyl and two methyl groups on the imidazolium ring contributes to its unique properties, including a relatively low melting point compared to traditional salts. This compound is typically colorless to pale yellow and exhibits good ionic conductivity, which is advantageous for electrochemical applications. Additionally, its bromide anion can influence its solubility and reactivity in different environments. As an ionic liquid, it is often considered more environmentally friendly than conventional solvents due to its negligible vapor pressure and potential for recyclability. However, the specific interactions and behavior of this compound can vary depending on the conditions and the presence of other substances in the system.
Formula:C7H13N2·Br
InChI:InChI=1S/C7H13N2.BrH/c1-4-9-6-5-8(3)7(9)2;/h5-6H,4H2,1-3H3;1H/q+1;/p-1
InChI key:InChIKey=GITMVCYKHULLDM-UHFFFAOYSA-M
SMILES:C(C)[N+]1=C(C)N(C)C=C1.[Br-]
Synonyms:
  • 1-Ethyl-2,3-dimethylimidazolium bromide
  • 1,2-Dimethyl-3-ethylimidazolium bromide
  • 1H-Imidazolium, 1-ethyl-2,3-dimethyl-, bromide
  • 1H-Imidazolium, 3-ethyl-1,2-dimethyl-, bromide (1:1)
Found 4 products.