CAS 98897-09-7

D-Glucopyranose,6-[(4-azido-2-hydroxybenzoyl)amino]-6-deoxy-

Description:

D-Glucopyranose, 6-[(4-azido-2-hydroxybenzoyl)amino]-6-deoxy- is a modified form of glucose, specifically a derivative of D-glucopyranose where a 4-azido-2-hydroxybenzoyl group is attached to the sixth carbon atom. This compound features a pyranose ring structure, characteristic of many sugars, which contributes to its biological activity and solubility in aqueous environments. The presence of the azido group introduces unique reactivity, allowing for potential applications in bioconjugation and click chemistry, while the hydroxyl group enhances its solubility and reactivity. The amino group facilitates further chemical modifications, making it versatile for various synthetic applications. This compound is typically used in biochemical research, particularly in studies involving glycosylation and the development of glycoprotein analogs. Its specific properties, such as stability, reactivity, and solubility, can vary based on environmental conditions and the presence of other functional groups. Overall, D-Glucopyranose, 6-[(4-azido-2-hydroxybenzoyl)amino]-6-deoxy- represents a significant tool in chemical biology and medicinal chemistry.

Formula: C₁₃H₁₆N₄O₇

InChI: InChI=1S/C13H16N4O7/c14-17-16-5-1-2-6(7(18)3-5)12(22)15-4-8-9(19)10(20)11(21)13(23)24-8/h1-3,8-11,13,18-21,23H,4H2,(H,15,22)/t8-,9-,10+,11-,13?/m1/s1

InChI key: AMENESIYYZEZKA-TWEVDUBQSA-N

SMILES: C1=CC(=C(C=C1N=[N+]=[N-])O)C(=O)NC[C@@H]2[C@H]([C@@H]([C@H](C(O2)O)O)O)O

Synonyms:

• 6-(4-Azido-2-Hydroxybenzamido)- 6-Deoxy-D-Glucopyranose

6-(4-Azido-2-hydroxybenzamido)-6-deoxy-D-glucopyranose

CAS: 98897-09-7

Ref: 7W-GC8192

6-(4-Azido-2-hydroxybenzamido)-6-deoxy-D-glucopyranose

CAS: 98897-09-7

6-(4-Azido-2-hydroxybenzamido)-6-deoxy-D-glucopyranose (AGB) is a potential photoaffinity label that can be used to identify and characterize the transporter. The photoaffinity label is synthesized by reacting 2,4-dinitrophenylhydrazine with 6-(4-azido-2-hydroxybenzamido)-6-deoxy-D-glucopyranose in the presence of sodium bicarbonate or potassium carbonate. The photolysis of AGB produces an azide radical cation that reacts with amino acid residues on the protein surface, forming a covalent bond. This labeling process is irreversible.

Formula: C₁₃H₁₆N₄O₇

Purity: Min. 95%

Molecular weight: 340.29 g/mol

Ref: 3D-MA04492