CAS 98897-36-0
:1-(4-fluorophenyl)-4-(4-methylpiperazin-1-yl)butan-1-one dihydrochloride
Description:
1-(4-fluorophenyl)-4-(4-methylpiperazin-1-yl)butan-1-one dihydrochloride, with the CAS number 98897-36-0, is a chemical compound that belongs to the class of substituted phenyl and piperazine derivatives. It typically exhibits characteristics such as a moderate molecular weight and a specific structural configuration that includes a fluorophenyl group and a piperazine moiety, which can influence its pharmacological properties. The dihydrochloride form indicates the presence of two hydrochloride ions, which can enhance solubility in aqueous solutions, making it suitable for various applications in medicinal chemistry. This compound may exhibit biological activity, potentially acting as a ligand for certain receptors or enzymes, and is often studied for its effects in neuropharmacology or related fields. Its synthesis and characterization involve standard organic chemistry techniques, and it is important to handle it with care due to potential biological activity and the need for proper safety protocols in laboratory settings.
Formula:C15H23Cl2FN2O
InChI:InChI=1/C15H21FN2O.2ClH/c1-17-9-11-18(12-10-17)8-2-3-15(19)13-4-6-14(16)7-5-13;;/h4-7H,2-3,8-12H2,1H3;2*1H
SMILES:CN1CCN(CCCC(=O)c2ccc(cc2)F)CC1.Cl.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(4-Fluorophenyl)-4-(4-methylpiperazin-1-yl)butan-1-one
CAS:1-(4-Fluorophenyl)-4-(4-methylpiperazin-1-yl)butan-1-oneFormula:C15H21FN2OPurity:techMolecular weight:264.33844
