CAS 989-23-1

1-(furan-3-yl)-4b,7,7,14a-tetramethyl-6a,7,12b,13,14,14a-hexahydro-1H,8aH-pyrano[4',3':3,3a][2]benzofuro[5,4-f]isochromene-3,5,10(4bH,6H,9H)-trione

Description:

The chemical substance known as 1-(furan-3-yl)-4b,7,7,14a-tetramethyl-6a,7,12b,13,14,14a-hexahydro-1H,8aH-pyrano[4',3':3,3a][2]benzofuro[5,4-f]isochromene-3,5,10(4bH,6H,9H)-trione, with the CAS number 989-23-1, is a complex organic compound characterized by its intricate polycyclic structure. This compound features multiple fused rings, including a furan moiety and a pyrano-benzofuro framework, which contribute to its unique chemical properties. It is likely to exhibit significant biological activity due to its structural complexity, potentially interacting with various biological targets. The presence of multiple methyl groups suggests that it may have enhanced lipophilicity, influencing its solubility and permeability in biological systems. Additionally, the trione functional groups indicate potential reactivity, which could be relevant in synthetic applications or biological interactions. Overall, this compound's unique structure and functional groups make it a subject of interest in fields such as medicinal chemistry and natural product synthesis.

Formula: C₂₆H₃₀O₇

InChI: InChI=1/C26H30O7/c1-23(2)16-9-18(27)25(4)15(26(16)13-31-20(28)11-19(26)33-23)5-7-24(3)17(25)10-21(29)32-22(24)14-6-8-30-12-14/h6,8,10,12,15-16,19,22H,5,7,9,11,13H2,1-4H3

InChI key: QUTATOGBENCRSS-JWLOEITESA-N

SMILES: CC1(C)C2CC(=O)C3(C)C(CCC4(C)C3=CC(=O)OC4c3ccoc3)C32COC(=O)CC3O1

Deoxylimonin

CAS: 989-23-1

Deoxylimonin

Formula: C₂₆H₃₀O₇

Purity: 99%

Molecular weight: 454.51

Ref: 54-BUP05498

Deoxylimonin

CAS: 989-23-1

Formula: C₂₆H₃₀O₇

Molecular weight: 454.52

Ref: 7W-GY0819

Deoxylimonin

CAS: 989-23-1

Formula: C₂₆H₃₀O₇

Purity: 95%~99%

Molecular weight: 454.519

Ref: BP-BP4391

Deoxylimonin

CAS: 989-23-1

Formula: C₂₆H₃₀O₇

Purity: 98%

Molecular weight: 454.5122

Ref: IN-DA01EE9H

Deoxylimonin

CAS: 989-23-1

Deoxylimonin (NSC 314317) is a triterpenoid isolated from grapefruit seeds.

Formula: C₂₆H₃₀O₇

Purity: 99.31% - 99.43%

Color and Shape: Solid

Molecular weight: 454.5122

Ref: TM-TN7059

Deoxylimonin

CAS: 989-23-1

Deoxylimonin is a limonoid compound, which is a type of organic molecule naturally derived from citrus fruits. It is extracted primarily from species such as lemons and oranges, where it exists as part of the secondary metabolite arsenal of the plant. This substance is structurally characterized by a furanolactone ring, which is a hallmark of limonoids.

Formula: C₂₆H₃₀O₇

Purity: Min. 95%

Molecular weight: 454.51 g/mol

Ref: 3D-XD161699