CymitQuimica logo

CAS 98902-12-6

:

N-methyl-N-[2-(methylamino)ethyl]benzamide

Description:
N-methyl-N-[2-(methylamino)ethyl]benzamide, with the CAS number 98902-12-6, is an organic compound characterized by its amide functional group, which is derived from benzoic acid. This compound features a benzene ring attached to a carbonyl group (C=O) linked to a nitrogen atom that is further substituted with a methyl group and a 2-(methylamino)ethyl chain. The presence of the methylamino group suggests that it may exhibit basic properties, potentially allowing it to form salts with acids. The molecular structure indicates that it may participate in hydrogen bonding due to the amide functionality, influencing its solubility and reactivity. Typically, compounds of this nature may be investigated for their biological activity, including potential pharmacological effects, due to the presence of both aromatic and amine functionalities. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the environment in which it is studied.
Formula:C11H16N2O
InChI:InChI=1/C11H16N2O/c1-12-8-9-13(2)11(14)10-6-4-3-5-7-10/h3-7,12H,8-9H2,1-2H3
SMILES:CNCCN(C)C(=O)c1ccccc1
Synonyms:
  • Benzamide, N-methyl-N-[2-(methylamino)ethyl]-
Found 2 products.