CymitQuimica logo

CAS 98947-00-3

:

(7-bromo-2,3-dihydro-1,4-benzodioxin-6-yl)acetate

Description:
(7-bromo-2,3-dihydro-1,4-benzodioxin-6-yl)acetate, with the CAS number 98947-00-3, is a chemical compound characterized by its unique structure that includes a benzodioxin moiety and a bromine substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its reactivity and interactions. The presence of the bromine atom may enhance its electrophilic character, making it potentially reactive in various chemical reactions, such as nucleophilic substitutions. The acetate functional group suggests that it can undergo hydrolysis to release acetic acid, which may be relevant in biological or environmental contexts. Additionally, compounds of this nature may possess interesting pharmacological properties, making them subjects of interest in medicinal chemistry. Its solubility, stability, and specific reactivity would depend on the solvent and conditions used, as well as the presence of other functional groups in the surrounding environment. Overall, this compound represents a class of organic molecules with diverse applications in research and industry.
Formula:C10H8BrO4
InChI:InChI=1/C10H9BrO4/c11-7-5-9-8(14-1-2-15-9)3-6(7)4-10(12)13/h3,5H,1-2,4H2,(H,12,13)/p-1
InChI key:RAWVTZMLRYXFNQ-UHFFFAOYSA-N
SMILES:C1COc2cc(c(cc2O1)CC(=O)[O-])Br
Found 3 products.