CymitQuimica logo

CAS 98959-56-9

:

1-Propanamine, 2-phenoxy-, hydrochloride (1:1)

Description:
1-Propanamine, 2-phenoxy-, hydrochloride (1:1), with the CAS number 98959-56-9, is an organic compound characterized by its amine functional group and phenoxy substituent. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in water. The presence of the propanamine moiety suggests that it may exhibit basic properties, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. The phenoxy group contributes to its potential biological activity, possibly influencing its interaction with biological systems. This compound may be utilized in pharmaceutical applications, particularly in the synthesis of biologically active molecules or as an intermediate in organic synthesis. Its safety and handling require standard precautions typical for amines and hydrochloride salts, including avoiding inhalation and skin contact. Overall, 1-Propanamine, 2-phenoxy-, hydrochloride is a versatile compound with potential applications in medicinal chemistry and research.
Formula:C9H13NO·ClH
InChI:InChI=1S/C9H13NO.ClH/c1-8(7-10)11-9-5-3-2-4-6-9;/h2-6,8H,7,10H2,1H3;1H
InChI key:InChIKey=CGOBBGUREQJPPH-UHFFFAOYSA-N
SMILES:O(C(CN)C)C1=CC=CC=C1.Cl
Synonyms:
  • 1-Propanamine, 2-phenoxy-, hydrochloride (1:1)
  • Propylamine, 2-phenoxy-, hydrochloride
Found 2 products.