CymitQuimica logo

CAS 98959-77-4

:

[2-(4-methoxyphenoxy)ethyl]ammonium chloride

Description:
[2-(4-methoxyphenoxy)ethyl]ammonium chloride, with the CAS number 98959-77-4, is a quaternary ammonium compound characterized by its structure, which includes a 4-methoxyphenoxy group attached to an ethyl chain and a positively charged ammonium ion. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the quaternary ammonium group, which enhances its ionic character. It is often used in various applications, including as a surfactant, in pharmaceuticals, and in biological research due to its ability to interact with biological membranes. The presence of the methoxy group can influence its hydrophobicity and biological activity. Additionally, the chloride ion serves as a counterion, contributing to the overall stability and solubility of the compound in aqueous solutions. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H14ClNO2
InChI:InChI=1/C9H13NO2.ClH/c1-11-8-2-4-9(5-3-8)12-7-6-10;/h2-5H,6-7,10H2,1H3;1H
Synonyms:
  • 2-(4-Methoxyphenoxy)Ethanaminium Chloride
Found 2 products.