CymitQuimica logo

CAS 98977-37-8

:

O1-tert-butyl O3-ethyl 4-oxoazepane-1,3-dicarboxylate

Description:
O1-tert-butyl O3-ethyl 4-oxoazepane-1,3-dicarboxylate, with the CAS number 98977-37-8, is a chemical compound characterized by its unique structure that includes a seven-membered azepane ring, which is substituted with both tert-butyl and ethyl groups, as well as dicarboxylate functionalities. This compound typically exhibits properties associated with its ester and carbonyl groups, such as reactivity in nucleophilic addition reactions and potential for hydrolysis under certain conditions. The presence of the oxo group contributes to its potential as a reactive intermediate in organic synthesis. Additionally, the steric bulk of the tert-butyl group may influence its solubility and reactivity, making it of interest in medicinal chemistry and materials science. The compound's specific physical properties, such as boiling point, melting point, and solubility, would depend on its molecular interactions and the environment in which it is studied. Overall, this compound's structural features suggest potential applications in various chemical synthesis processes.
Formula:C14H23NO5
InChI:InChI=1/C14H23NO5/c1-5-19-12(17)10-9-15(8-6-7-11(10)16)13(18)20-14(2,3)4/h10H,5-9H2,1-4H3
InChI key:JHXZHJRQFDJAPP-UHFFFAOYSA-N
SMILES:CCOC(=O)C1CN(CCCC1=O)C(=O)OC(C)(C)C
Synonyms:
  • 1-tert-Butyl 3-ethyl 4-oxoazepane-1,3-dicarboxylate
  • Ethyl 1-Boc-4-oxo-3-azepanecarboxylate
  • T7N Dvtj Avox1& 1& 1 Cvo2
Found 4 products.