CAS 98983-40-5
:9-(2-Deoxy-2-fluoro-beta-D-arabinofuranosyl)-1,9-dihydro-6H-purin-6-one
Description:
9-(2-Deoxy-2-fluoro-beta-D-arabinofuranosyl)-1,9-dihydro-6H-purin-6-one, commonly referred to as a nucleoside analog, is characterized by its structural features that include a purine base and a modified sugar moiety. The presence of a fluorine atom at the 2-position of the deoxyribose sugar enhances its stability and bioactivity, making it of interest in medicinal chemistry, particularly in antiviral and anticancer research. This compound exhibits properties typical of nucleosides, such as the ability to participate in nucleic acid synthesis and interactions with nucleic acid polymerases. Its purine base structure allows it to mimic natural nucleosides, potentially interfering with viral replication or cellular processes. The compound's solubility, stability, and reactivity are influenced by the presence of the fluorine atom, which can alter hydrogen bonding and steric interactions. Overall, this substance represents a significant area of study for developing therapeutic agents targeting various diseases, including viral infections and cancer.
Formula:C10H11FN4O4
InChI:InChI=1/C10H11FN4O4/c11-5-7(17)4(1-16)19-10(5)15-3-14-6-8(15)12-2-13-9(6)18/h2-5,7,10,16-17H,1H2,(H,12,13,18)/t4-,5+,7-,10-/m1/s1
Synonyms:- 6H-purin-6-one, 9-(2-deoxy-2-fluoro-beta-D-arabinofuranosyl)-1,9-dihydro-
- 9-(2-deoxy-2-fluoro-D-arabinofuranosyl)hypoxanthin
- 9-(2-Deoxy-2-fluoro-beta-D-arabinofuranosyl)-1,9-dihydro-6H-purin-6-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
9-((2R,3S,4R,5R)-3-Fluoro-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-1,9-dihydro-6H-purin-6-one
CAS:9-((2R,3S,4R,5R)-3-Fluoro-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-1,9-dihydro-6H-purin-6-oneFormula:C10H11FN4O4Purity:95%Molecular weight:270.222’-Deoxy-2’-fluoroarabino inosine
CAS:9-((2R,3S,4R,5R)-3-Fluoro-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-1,9-dihydro-6H-purin-6-oneFormula:C10H11FN4O4Purity:95%Molecular weight:270.222'-Deoxy-2'-fluoroarabino inosine
CAS:2'-Deoxy-2'-fluoroarabino inosine is a Nucleoside Derivative - 2'-Modified nucleoside, Fluoro-modified nucleoside.Formula:C10H11FN4O4Color and Shape:SolidMolecular weight:270.22Ref: TM-TNU1502
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire9-(2'-Deoxy-2'-fluoro-β-D-arabinofuranosyl)hypoxantine
CAS:9-(2'-Deoxy-2'-fluoro-β-D-arabinofuranosyl)hypoxantine is a synthetic nucleoside that can be phosphorylated to form 9-(2'-Deoxy-2'-fluoro-β-D-arabinofuranosyl)hypoxantine 5'-triphosphate. This compound has been shown to have antitumor and antiviral activities. It inhibits DNA synthesis by inhibiting the activity of DNA polymerase and RNA polymerase, which are enzymes necessary for the replication of cellular DNA and RNA, respectively. 9-(2'-Deoxy-2'-fluoro-β-D-arabinofuranosyl)hypoxantine is high quality, novel, and CAS No. 98983-40-5.Formula:C10H11FN4O4Purity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:270.22 g/mol





