CAS 98985-24-1

6-oxocevan-2-yl hexopyranoside

Description:

6-Oxocevan-2-yl hexopyranoside, identified by its CAS number 98985-24-1, is a glycoside compound characterized by the presence of a hexopyranoside moiety linked to a 6-oxocevan-2-yl group. This compound typically exhibits properties associated with both carbohydrate and lipid-like structures, which may influence its solubility and reactivity. The hexopyranoside part suggests that it contains a six-membered sugar ring, which is likely to participate in hydrogen bonding and other interactions, affecting its biological activity and stability. The presence of the oxocevan structure indicates potential applications in medicinal chemistry, possibly due to its unique structural features that may interact with biological targets. Additionally, compounds of this nature can exhibit various functional properties, including antioxidant or antimicrobial activities, depending on their specific molecular configuration. As with many glycosides, the compound may also be subject to enzymatic hydrolysis, leading to the release of the sugar and the aglycone, which can further influence its biological effects.

Formula: C₃₃H₅₃NO₇

InChI: InChI=1/C33H53NO7/c1-16-4-9-26-17(2)19-6-7-20-21(23(19)14-34(26)13-16)10-25-22(20)11-27(36)24-8-5-18(12-33(24,25)3)40-32-31(39)30(38)29(37)28(15-35)41-32/h16-26,28-32,35,37-39H,4-15H2,1-3H3

SMILES: CC1CCC2C(C)C3CCC4C(CC5C4CC(=O)C4CCC(CC54C)OC4C(C(C(C(CO)O4)O)O)O)C3CN2C1

Yibeinoside A

CAS: 98985-24-1

Yibeinoside A

Molecular weight: 573.4

Ref: 10-F564153

yibeinoside A

CAS: 98985-24-1

yibeinoside A

Formula: C₃₃H₅₃NO₇

Purity: 99.5%

Molecular weight: 575.787

Ref: 54-BUP03806

Yibeinoside A

CAS: 98985-24-1

Formula: C₃₃H₅₃NO₇

Purity: 95%~99%

Molecular weight: 575.787

Ref: BP-BP4395

Yibeinoside A

CAS: 98985-24-1

Formula: C₃₃H₅₃NO₇

Purity: 98%

Molecular weight: 575.7764

Ref: IN-DA01DDG7

yibeinoside A

CAS: 98985-24-1

Yibeinoside A (Sinpeinine-3-O-β-glucoside) is an alkaloid from Fritillaria pallidiflora.

Formula: C₃₃H₅₃NO₇

Purity: 99.84% - 99.89%

Color and Shape: White Solid

Molecular weight: 575.7764

Ref: TM-T2S0112