CAS 99-32-1: Chelidonic acid
Description:Chelidonic acid, with the CAS number 99-32-1, is a dicarboxylic acid characterized by its structure, which includes two carboxyl (-COOH) groups. It is derived from the plant Chelidonium majus, commonly known as greater celandine. This compound typically appears as a white crystalline solid and is soluble in water, reflecting its polar nature due to the presence of carboxylic acid functional groups. Chelidonic acid is known for its potential biological activities, including antimicrobial and anti-inflammatory properties, which have garnered interest in pharmacological research. Additionally, it can participate in various chemical reactions, such as esterification and decarboxylation, making it a useful intermediate in organic synthesis. Its reactivity and functional groups allow it to form derivatives that may exhibit different properties and applications in medicinal chemistry and other fields. Overall, chelidonic acid is a compound of interest due to its natural origin and potential therapeutic benefits.
Formula:C7H4O6
InChI:InChI=1S/C7H4O6/c8-3-1-4(6(9)10)13-5(2-3)7(11)12/h1-2H,(H,9,10)(H,11,12)
InChI key:InChIKey=PBAYDYUZOSNJGU-UHFFFAOYSA-N
SMILES:O=C(O)C=1OC(=CC(=O)C1)C(=O)O
- Synonyms:
- 2,6-Dicarboxy-4-pyrone
- 4-Oxo-1,4-pyran-2,6-dicarboxylic acid
- 4-Pyranone-2,6-dicarboxylic acid
- 4-oxo-4H-pyran-2,6-dicarboxylic acid
- 4H-Pyran-2,6-dicarboxylic acid, 4-oxo-
- Jerva acid
- Jervaic acid
- Jervasic acid
- NSC 3979
- γ-Pyrone-2,6-dicarboxylic acid
- See more synonyms
- Chelidonic acid
