CAS 99-32-1
:Chelidonic acid
Description:
Chelidonic acid, with the CAS number 99-32-1, is a dicarboxylic acid characterized by its structure, which includes two carboxyl (-COOH) groups. It is derived from the plant Chelidonium majus, commonly known as greater celandine. This compound typically appears as a white crystalline solid and is soluble in water, reflecting its polar nature due to the presence of carboxylic acid functional groups. Chelidonic acid is known for its potential biological activities, including antimicrobial and anti-inflammatory properties, which have garnered interest in pharmacological research. Additionally, it can participate in various chemical reactions, such as esterification and decarboxylation, making it a useful intermediate in organic synthesis. Its reactivity and functional groups allow it to form derivatives that may exhibit different properties and applications in medicinal chemistry and other fields. Overall, chelidonic acid is a compound of interest due to its natural origin and potential therapeutic benefits.
Formula:C7H4O6
InChI:InChI=1S/C7H4O6/c8-3-1-4(6(9)10)13-5(2-3)7(11)12/h1-2H,(H,9,10)(H,11,12)
InChI key:InChIKey=PBAYDYUZOSNJGU-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1OC(C(O)=O)=CC(=O)C1
Synonyms:- 2,6-Dicarboxy-4-pyrone
- 4-Oxo-1,4-pyran-2,6-dicarboxylic acid
- 4-Pyranone-2,6-dicarboxylic acid
- 4-oxo-4H-pyran-2,6-dicarboxylic acid
- 4H-Pyran-2,6-dicarboxylic acid, 4-oxo-
- Jerva acid
- Jervaic acid
- Jervasic acid
- NSC 3979
- γ-Pyrone-2,6-dicarboxylic acid
- Chelidonic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
Chelidonic acid
CAS:4-Oxo-4H-pyran-2,6-dicarboxylic acidFormula:C7H4O6Purity:98% (contains <2%H2O)Molecular weight:184.14-Oxo-4H-pyran-2,6-dicarboxylic acid
CAS:Formula:C7H4O6Purity:96%Color and Shape:SolidMolecular weight:184.1031Chelidonic acid (Standard)
CAS:Chelidonic acid (Standard) is a reference standard for research and analysis in studies involving Chelidonic acid. Chelidonic acid (Jervaic acid) is a component of Chelidonium majus L., used as a mild analgesic, an antimicrobial, an acentral nervous system sedative. Chelidonic acid (Jervaic acid) also shows anti-inflammatory activity.Formula:C7H4O6Molecular weight:184.10Chelidonic acid
CAS:Chelidonic acid, in Chelidonium majus, acts as an analgesic, antimicrobial, CNS sedative, and has anti-inflammatory properties.Formula:C7H4O6Purity:99.03%Color and Shape:SolidMolecular weight:184.10Chelidonic acid
CAS:Oxygen-heterocyclic compoundFormula:C7H4O6Purity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:184.14-Oxo-4H-pyran-2,6-dicarboxylic acid
CAS:Formula:C7H4O6Purity:95%Color and Shape:SolidMolecular weight:184.103Chelidonic acid
CAS:Chelidonic acid is a natural compound that is found in many plants, including the bark of the canna tree. Chelidonic acid has been shown to inhibit enzymes responsible for the degradation of dextran sulfate and p-hydroxybenzoic acid. Chelidonic acid also has immunomodulatory effects on cells, which may be due to its ability to inhibit glutamate release from macrophages. Chelidonic acid is used as a chemical precursor in pharmaceutical preparations such as protocatechuic acid. It can be synthesized by reacting hydrochloric acid with chelidonium majus extract.Formula:C7H4O6Purity:Min. 95%Color and Shape:PowderMolecular weight:184.1 g/mol








