CymitQuimica logo

CAS 99057-99-5

:

2-[(6-bromoquinazolin-4-yl)amino]ethanol

Description:
2-[(6-bromoquinazolin-4-yl)amino]ethanol is a chemical compound characterized by its unique structure, which includes a quinazoline ring substituted with a bromine atom and an aminoethanol group. This compound typically exhibits properties associated with both the quinazoline moiety and the amino alcohol functional group. It is likely to be a solid at room temperature, with potential solubility in polar solvents due to the presence of the hydroxyl (-OH) group. The bromine substitution can influence its reactivity and biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may also exhibit specific interactions with biological targets, potentially acting as an inhibitor or modulator in various biochemical pathways. Its molecular structure suggests potential applications in research related to cancer, as quinazoline derivatives are often explored for their antitumor properties. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogen substituents.
Formula:C10H10BrN3O
InChI:InChI=1/C10H10BrN3O/c11-7-1-2-9-8(5-7)10(12-3-4-15)14-6-13-9/h1-2,5-6,15H,3-4H2,(H,12,13,14)
InChI key:BUYXDOBAKHYWFG-UHFFFAOYSA-N
SMILES:c1cc2c(cc1Br)c(=NCCO)[nH]cn2
Synonyms:
  • Ethanol, 2-[(6-Bromo-4-Quinazolinyl)Amino]-
Found 2 products.