CymitQuimica logo

CAS 99059-64-0

:

3-iodo-4-isopropyl-benzoic acid

Description:
3-Iodo-4-isopropylbenzoic acid is an aromatic carboxylic acid characterized by the presence of an isopropyl group and an iodine atom attached to a benzene ring. The compound features a benzoic acid structure, which includes a carboxylic acid functional group (-COOH) that contributes to its acidic properties. The iodine substituent at the meta position (3-position) and the isopropyl group at the para position (4-position) influence the compound's reactivity and physical properties, such as solubility and boiling point. Generally, compounds like this may exhibit moderate solubility in organic solvents and limited solubility in water due to the hydrophobic nature of the isopropyl group. The presence of the iodine atom can also enhance the compound's reactivity in nucleophilic substitution reactions. Additionally, the compound may have applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H11IO2
InChI:InChI=1/C10H11IO2/c1-6(2)8-4-3-7(10(12)13)5-9(8)11/h3-6H,1-2H3,(H,12,13)
InChI key:YKYRHJJXCOILPA-UHFFFAOYSA-N
SMILES:CC(C)c1ccc(cc1I)C(=O)O
Found 3 products.