CymitQuimica logo

CAS 99067-25-1

:

1,4-Benzodioxin-6-carboxaldehyde, 7-bromo-2,3-dihydro-

Description:
1,4-Benzodioxin-6-carboxaldehyde, 7-bromo-2,3-dihydro- is an organic compound characterized by its unique bicyclic structure, which includes a benzodioxin moiety and an aldehyde functional group. This compound features a bromine substituent at the 7-position, contributing to its reactivity and potential applications in organic synthesis. The presence of the carboxaldehyde group indicates that it can participate in various chemical reactions, such as nucleophilic additions and condensation reactions. The compound is typically used in research settings, particularly in the development of pharmaceuticals and agrochemicals, due to its potential biological activity. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. Safety data should be consulted, as halogenated compounds like this one may pose health risks if not handled properly. Overall, 1,4-Benzodioxin-6-carboxaldehyde, 7-bromo-2,3-dihydro- is a valuable compound in the field of synthetic organic chemistry.
Formula:C9H7BrO3
InChI:InChI=1S/C9H7BrO3/c10-7-4-9-8(3-6(7)5-11)12-1-2-13-9/h3-5H,1-2H2
InChI key:GRPOMPOKJNVQKD-UHFFFAOYSA-N
SMILES:C1COC2=C(O1)C=C(C(=C2)Br)C=O
Found 3 products.