CymitQuimica logo

CAS 99070-18-5

:

4-Bromo-α-ethylbenzeneacetic acid

Description:
4-Bromo-α-ethylbenzeneacetic acid, with the CAS number 99070-18-5, is an organic compound characterized by the presence of a bromine atom, an ethyl group, and a carboxylic acid functional group. This compound features a benzene ring substituted with a bromine atom at the para position relative to the ethyl side chain, which contributes to its unique chemical properties. The carboxylic acid group (-COOH) imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and acid-base reactions. The presence of the bromine atom can enhance the compound's reactivity and influence its physical properties, such as solubility and boiling point. Typically, compounds like this may exhibit moderate to low solubility in water but higher solubility in organic solvents. Additionally, the compound may have applications in organic synthesis, pharmaceuticals, or as an intermediate in chemical manufacturing. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.
Formula:C10H11BrO2
InChI:InChI=1S/C10H11BrO2/c1-2-9(10(12)13)7-3-5-8(11)6-4-7/h3-6,9H,2H2,1H3,(H,12,13)
InChI key:InChIKey=XVEFRABIRRNWFO-UHFFFAOYSA-N
SMILES:C(C(O)=O)(CC)C1=CC=C(Br)C=C1
Synonyms:
  • Butyric acid, 2-(p-bromophenyl)-
  • 4-Bromo-α-ethylbenzeneacetic acid
  • Benzeneacetic acid, 4-bromo-α-ethyl-
  • 2-(4-Bromophenyl)butyric acid
Found 5 products.