CymitQuimica logo

CAS 99073-84-4

:

2-bromo-4-(4-methoxyphenyl)thiazole

Description:
2-Bromo-4-(4-methoxyphenyl)thiazole is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The presence of a bromine atom at the 2-position and a para-methoxyphenyl group at the 4-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents, reflecting its aromatic character and the influence of the methoxy group, which can enhance solubility due to its electron-donating properties. The thiazole moiety is known for its biological activity, making this compound of interest in medicinal chemistry. It may exhibit various pharmacological effects, including antimicrobial or anti-inflammatory properties, although specific biological activities would depend on further empirical studies. Additionally, the presence of the bromine atom can enhance reactivity in substitution reactions, making it a useful intermediate in organic synthesis. Overall, 2-bromo-4-(4-methoxyphenyl)thiazole is a compound with significant potential for research and application in various chemical and pharmaceutical contexts.
Formula:C10H8BrNOS
InChI:InChI=1/C10H8BrNOS/c1-13-8-4-2-7(3-5-8)9-6-14-10(11)12-9/h2-6H,1H3
InChI key:FBYVCEPGVMXUCI-UHFFFAOYSA-N
SMILES:COc1ccc(cc1)c1csc(Br)n1
Synonyms:
  • 2-Bromo-4-(4-Methoxyphenyl)-1,3-Thiazole
  • Thiazole, 2-Bromo-4-(4-Methoxyphenyl)-
Found 2 products.