CymitQuimica logo

CAS 99073-88-8

:

Ethyl 2-bromo-1,3-benzothiazole-6-carboxylate

Description:
Ethyl 2-bromo-1,3-benzothiazole-6-carboxylate is a chemical compound characterized by its unique structure, which includes a benzothiazole ring, a carboxylate group, and a bromine substituent. This compound typically appears as a solid or liquid, depending on its purity and environmental conditions. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to the presence of the benzothiazole moiety, which is often associated with biological activity. The ethyl ester group enhances its solubility in organic solvents, making it useful in various synthetic reactions. Additionally, the bromine atom can serve as a site for further chemical modifications, allowing for the synthesis of derivatives with tailored properties. Safety data sheets indicate that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, Ethyl 2-bromo-1,3-benzothiazole-6-carboxylate is a versatile compound with significant relevance in chemical research and development.
Formula:C10H8BrNO2S
InChI:InChI=1/C10H8BrNO2S/c1-2-14-9(13)6-3-4-7-8(5-6)15-10(11)12-7/h3-5H,2H2,1H3
InChI key:JQZQKEZCRZNJPC-UHFFFAOYSA-N
SMILES:CCOC(=O)c1ccc2c(c1)sc(Br)n2
Synonyms:
  • 6-Benzothiazolecarboxylic Acid, 2-Bromo-, Ethyl Ester
  • 2-Bromo-benzothiazole-6-carboxylic acid ethyl ester
Found 4 products.