CymitQuimica logo

CAS 99075-24-8

:

4-(2-Aminoethyl)benzeneacetic acid

Description:
4-(2-Aminoethyl)benzeneacetic acid, also known by its CAS number 99075-24-8, is an organic compound characterized by the presence of both an amino group and a carboxylic acid functional group. This compound features a benzene ring substituted with an aminoethyl side chain and an acetic acid moiety, which contributes to its polar nature. It is typically a white to off-white solid at room temperature and is soluble in water due to the hydrophilic nature of the amino and carboxylic acid groups. The presence of the amino group allows for potential interactions with biological systems, making it of interest in pharmaceutical and biochemical research. Its structure suggests it may participate in various chemical reactions, including amide formation and esterification. Additionally, the compound may exhibit properties such as buffering capacity and the ability to form salts, which can influence its behavior in different environments. Overall, 4-(2-Aminoethyl)benzeneacetic acid is a versatile compound with potential applications in medicinal chemistry and biochemistry.
Formula:C10H13NO2
InChI:InChI=1S/C10H13NO2/c11-6-5-8-1-3-9(4-2-8)7-10(12)13/h1-4H,5-7,11H2,(H,12,13)
InChI key:YNRWSYQPUZZUGC-UHFFFAOYSA-N
SMILES:c1cc(ccc1CCN)CC(=O)O
Synonyms:
  • [p-(2-Aminoethyl)phenyl]acetic acid
  • [4-(2-Aminoethyl)phenyl]acetic acid
  • 4-<2-Amino-aethyl>-phenylessigsaeure
  • 2-(4-(2-AMinoethyl)phenyl)acetic acid
  • Benzeneacetic acid, 4-(2-aminoethyl)-
  • 4-(2-Aminoethyl)benzeneacetic acid
  • [4-(2-AMINO-ETHYL)-PHENYL]-ACETIC ACID
Found 2 products.