CymitQuimica logo

CAS 99092-88-3

:

Boc-D-Gln(Xan)-OH

Description:
Boc-D-Gln(Xan)-OH, with the CAS number 99092-88-3, is a derivative of the amino acid glutamine, modified with a tert-butyloxycarbonyl (Boc) protecting group and a xanthenyl side chain. This compound is typically used in peptide synthesis and research due to its ability to protect the amino group during chemical reactions, allowing for selective modifications of other functional groups. The presence of the xanthenyl moiety can impart unique properties, such as enhanced solubility or specific reactivity, making it valuable in the development of bioactive peptides or pharmaceuticals. The Boc group is easily removable under acidic conditions, facilitating the deprotection process when the desired peptide or compound is synthesized. Overall, Boc-D-Gln(Xan)-OH serves as a versatile building block in organic and medicinal chemistry, particularly in the synthesis of complex peptide structures. Its stability, reactivity, and functional versatility make it an important compound in the field of chemical biology and drug development.
Formula:C23H26N2O6
InChI:InChI=1S/C23H26N2O6/c1-23(2,3)31-22(29)24-16(21(27)28)12-13-19(26)25-20-14-8-4-6-10-17(14)30-18-11-7-5-9-15(18)20/h4-11,16,20H,12-13H2,1-3H3,(H,24,29)(H,25,26)(H,27,28)/t16-/m1/s1
InChI key:HOIIDGIJEPOSLL-MRXNPFEDSA-N
SMILES:CC(C)(C)OC(=O)N[C@H](CCC(=O)NC1C2=CC=CC=C2OC3=CC=CC=C13)C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.