CAS 991-01-5
:Isodesmosine
Description:
Isodesmosine is a unique cross-linking amino acid primarily found in elastin, a key protein that provides elasticity to connective tissues in the body. It is characterized by its complex structure, which includes a pyridinoline ring and multiple functional groups that facilitate its role in stabilizing the elastin fibers. Isodesmosine is notable for its ability to form covalent bonds between elastin molecules, contributing to the mechanical properties and resilience of tissues such as skin, lungs, and blood vessels. The presence of isodesmosine can be indicative of elastin degradation, making it a potential biomarker for various diseases related to connective tissue. Its molecular formula reflects its composition of carbon, hydrogen, nitrogen, and oxygen, and it is soluble in water, which is essential for its biological functions. The study of isodesmosine is significant in fields such as biochemistry, medicine, and materials science, particularly in understanding aging and diseases that affect connective tissues.
Formula:C24H40N5O8
InChI:InChI=1S/C24H39N5O8/c25-16(21(30)31)4-1-2-11-29-13-14(7-9-18(27)23(34)35)12-15(8-10-19(28)24(36)37)20(29)6-3-5-17(26)22(32)33/h12-13,16-19H,1-11,25-28H2,(H3-,30,31,32,33,34,35,36,37)/p+1/t16-,17-,18-,19-/m0/s1
InChI key:InChIKey=RGXCTRIQQODGIZ-VJANTYMQSA-O
SMILES:C(CC[C@@H](C(O)=O)N)C1=C(CC[C@@H](C(O)=O)N)C=C(CC[C@@H](C(O)=O)N)C=[N+]1CCCC[C@@H](C(O)=O)N
Synonyms:- 2-(4-amino-4-carboxybutyl)-1-(5-amino-5-carboxypentyl)-3,5-bis(3-amino-3-carboxypropyl)-Pyridinium
- 2-[(4S)-4-Amino-4-carboxybutyl]-1-[(5S)-5-amino-5-carboxypentyl]-3,5-bis[(3S)-3-amino-3-carboxypropyl]pyridinium
- 6-[2-(4-Amino-4-carboxybutyl)-3,5-bis(3-amino-3-carboxypropyl)-1-pyridiniumyl]norleucine
- Isodesmosine
- Norleucine, 6-[2-(4-Amino-4-Carboxybutyl)-3,5-Bis(3-Amino-3-Carboxypropyl)Pyridinio]-
- Pyridinium, 2-(4-amino-4-carboxybutyl)-1-(5-amino-5-carboxypentyl)-3,5-bis(3-amino-3-carboxypropyl)-
- Pyridinium, 2-[(4S)-4-amino-4-carboxybutyl]-1-[(5S)-5-amino-5-carboxypentyl]-3,5-bis[(3S)-3-amino-3-carboxypropyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Isodesmosine Chloride Hydrate-d4
CAS:Controlled ProductFormula:C24H36D4N5O8·Cl·H2OColor and Shape:NeatMolecular weight:531.621Isodesmosine
CAS:Isodesmosine is an amino acid and naturally occurring cross-linking compound, which is primarily found in elastin, a key protein in connective tissues. Its source is the structural protein elastin, where it forms stable cross-links that contribute to the elasticity and resilience of various tissues, notably the skin, lungs, and blood vessels. The mode of action of isodesmosine involves its integration into the elastin matrix, providing durability and elasticity through covalent bonding within and between polypeptide chains.Formula:C24H40N5O8Purity:Min. 95%Molecular weight:526.6 g/mol

