CAS 99119-73-0
:2-(2,4-Dihydroxyphenyl)-3,5,7-trihydroxy-8-[(2R)-5-methyl-2-(1-methylethenyl)-4-hexen-1-yl]-4H-1-benzopyran-4-one
Description:
The chemical substance known as 2-(2,4-Dihydroxyphenyl)-3,5,7-trihydroxy-8-[(2R)-5-methyl-2-(1-methylethenyl)-4-hexen-1-yl]-4H-1-benzopyran-4-one, with the CAS number 99119-73-0, is a flavonoid compound characterized by its complex polyphenolic structure. This compound features multiple hydroxyl groups, which contribute to its potential antioxidant properties. The presence of a benzopyran moiety indicates that it belongs to the flavonoid class, which is known for various biological activities, including anti-inflammatory and anti-cancer effects. The specific arrangement of substituents, including the aliphatic side chain, suggests that it may exhibit unique interactions with biological targets. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in pharmaceuticals or nutraceuticals. Overall, this compound's structural features suggest it may have significant potential in medicinal chemistry and functional food applications, warranting further investigation into its biological activities and therapeutic potential.
Formula:C25H26O7
InChI:InChI=1S/C25H26O7/c1-12(2)5-6-14(13(3)4)9-17-19(28)11-20(29)21-22(30)23(31)25(32-24(17)21)16-8-7-15(26)10-18(16)27/h5,7-8,10-11,14,26-29,31H,3,6,9H2,1-2,4H3/t14-/m1/s1
InChI key:InChIKey=WAAPHYJTKSTXSX-CQSZACIVSA-N
SMILES:C([C@@H](CC=C(C)C)C(C)=C)C1=C2C(C(=O)C(O)=C(O2)C3=C(O)C=C(O)C=C3)=C(O)C=C1O
Synonyms:- 2-(2,4-Dihydroxyphenyl)-3,5,7-trihydroxy-8-[(2R)-5-methyl-2-(1-methylethenyl)-4-hexen-1-yl]-4H-1-benzopyran-4-one
- Kushenol C
- 4H-1-Benzopyran-4-one, 2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-[(2R)-5-methyl-2-(1-methylethenyl)-4-hexenyl]-
- 4H-1-Benzopyran-4-one, 2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-[(2R)-5-methyl-2-(1-methylethenyl)-4-hexen-1-yl]-
- 4H-1-Benzopyran-4-one, 2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-[5-methyl-2-(1-methylethenyl)-4-hexenyl]-, (R)-
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Kushenol C
CAS:Kushenol C: Antioxidant, SGLT2 inhibitor, fights S. aureus & S. mutans, may prevent/treat Alzheimer's by inhibiting BACE1 (IC50 5.45μM).Formula:C25H26O7Purity:98%Color and Shape:SolidMolecular weight:438.47Kushenol C
CAS:Kushenol C is a flavonoid compound, which is a type of secondary metabolite derived from the roots of Sophora flavescens, a plant commonly found in East Asia. This compound is characterized by its complex structure and belongs to a class of polyphenolic compounds known for diverse bioactivities. The source of Kushenol C, Sophora flavescens, has been historically utilized in traditional medicine for various therapeutic purposes.
Formula:C25H26O7Purity:Min. 95%Molecular weight:438.5 g/mol




