CymitQuimica logo

CAS 99171-23-0

:

5-Pyrimidinesulfonamide,2-amino-

Description:
5-Pyrimidinesulfonamide, 2-amino- is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a sulfonamide functional group, which is characterized by the presence of a sulfonyl group (–SO2) attached to an amine. The amino group at position 2 of the pyrimidine ring contributes to its basicity and potential reactivity. This compound may exhibit properties typical of sulfonamides, such as antibacterial activity, due to its ability to inhibit bacterial folic acid synthesis. Additionally, the presence of the pyrimidine ring may impart specific pharmacological properties, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on the surrounding conditions, such as pH and solvent. Overall, 5-Pyrimidinesulfonamide, 2-amino- is a compound of interest in various fields, including pharmaceuticals and biochemistry, due to its structural features and potential biological activities.
Formula:C4H6N4O2S
InChI:InChI=1S/C4H6N4O2S/c5-4-7-1-3(2-8-4)11(6,9)10/h1-2H,(H2,5,7,8)(H2,6,9,10)
InChI key:QDRARHQVEYBKSS-UHFFFAOYSA-N
SMILES:C1=C(C=NC(=N1)N)S(=O)(=O)N
Synonyms:
  • 2-Amino-Pyrimidine-5-Sulfonic Acid Amide
  • 2-Amino-5-Pyrimidinesulfonamide
  • 5-Pyrimidinesulfonamide,2-amino-(6CI)
Found 2 products.