CymitQuimica logo

CAS 99210-90-9

:

R(-)-2-methyl-2,4-pentanediol

Description:
R(-)-2-methyl-2,4-pentanediol, with the CAS number 99210-90-9, is a chiral organic compound characterized by its two hydroxyl (-OH) functional groups, which classify it as a diol. This compound features a branched structure, with a methyl group attached to the second carbon of a five-carbon chain, contributing to its unique stereochemistry. It is typically a colorless, viscous liquid at room temperature, exhibiting moderate solubility in water due to the presence of hydroxyl groups, which can form hydrogen bonds. R(-)-2-methyl-2,4-pentanediol is known for its use as a solvent and in various chemical syntheses, particularly in the production of pharmaceuticals and other fine chemicals. Its chiral nature allows it to participate in asymmetric synthesis, making it valuable in the development of enantiomerically pure compounds. Additionally, it has potential applications in cosmetics and personal care products due to its moisturizing properties. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C6H14O2
InChI:InChI=1S/C6H14O2/c1-5(7)4-6(2,3)8/h5,7-8H,4H2,1-3H3/t5-/m1/s1
InChI key:SVTBMSDMJJWYQN-RXMQYKEDSA-N
SMILES:C[C@H](CC(C)(C)O)O
Synonyms:
  • (R)-(-)-Hexylene glycol
  • (R)-(-)-2-Methyl-2,4-pentanediol
Found 2 products.