CAS 99212-30-3
:Deoxyfuconojirimycin
Description:
Deoxyfuconojirimycin is a chemical compound classified as an imino sugar, which is a type of carbohydrate analog that inhibits glycosidases, enzymes responsible for the hydrolysis of glycosidic bonds in carbohydrates. Its structure features a pyrrolidine ring, which contributes to its biological activity. This compound is primarily studied for its potential therapeutic applications, particularly in the treatment of viral infections and certain types of cancer, due to its ability to interfere with glycoprotein processing. Deoxyfuconojirimycin has been shown to exhibit anti-HIV activity by inhibiting the replication of the virus. Additionally, it may have implications in the field of glycomics, where understanding carbohydrate interactions is crucial. The compound is typically characterized by its solubility in water and organic solvents, and its stability under various conditions. As with many imino sugars, its biological effects are closely linked to its ability to mimic natural sugars, allowing it to interact with biological systems in unique ways.
Formula:C6H13NO3
InChI:InChI=1S/C6H13NO3/c1-3-5(9)6(10)4(8)2-7-3/h3-10H,2H2,1H3/t3-,4+,5+,6-/m0/s1
InChI key:InChIKey=VYOCYWDJTQRZLC-KCDKBNATSA-N
SMILES:O[C@@H]1[C@H](O)[C@H](C)NC[C@H]1O
Synonyms:- (2S,3R,4S,5R)-2-Methyl-3,4,5-piperidinetriol
- (2S,3R,4S,5R)-2-methylpiperidine-3,4,5-triol
- 1,5-Dideoxy-1,5-imino-<span class="text-smallcaps">L</span>-fucitol
- 1-Deoxyfuconojirimycin
- 3,4,5-Piperidinetriol, 2-methyl-, (2S,3R,4S,5R)-
- 3,4,5-Piperidinetriol, 2-methyl-, [2S-(2α,3α,4α,5β)]-
- <span class="text-smallcaps">L</span>-fuco-Deoxynojirimycin
- Deoxyfuconojirimycin, Hydrochloride
- L-Deoxyfuconojirimycin
- 1,5-Dideoxy-1,5-imino-L-fucitol
- Deoxyfuconojirimycin
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
