CymitQuimica logo

CAS 99216-79-2

:

1-[(4-methylphenyl)amino]cyclohexanecarboxylic acid

Description:
1-[(4-methylphenyl)amino]cyclohexanecarboxylic acid, identified by its CAS number 99216-79-2, is an organic compound characterized by its cyclohexane structure substituted with an amino group and a carboxylic acid functional group. The presence of the 4-methylphenyl group indicates that there is a para-methyl substitution on the phenyl ring, which can influence the compound's solubility and reactivity. This compound typically exhibits properties associated with both amines and carboxylic acids, such as potential hydrogen bonding and varying degrees of acidity. Its molecular structure suggests it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can interact with biological systems. Additionally, the compound's characteristics, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the environment in which it is studied. Overall, this compound represents a class of molecules that may exhibit interesting biological activities and chemical reactivity.
Formula:C14H19NO2
InChI:InChI=1/C14H19NO2/c1-11-5-7-12(8-6-11)15-14(13(16)17)9-3-2-4-10-14/h5-8,15H,2-4,9-10H2,1H3,(H,16,17)
SMILES:Cc1ccc(cc1)NC1(CCCCC1)C(=O)O
Synonyms:
  • Cyclohexanecarboxylic acid, 1-[(4-methylphenyl)amino]-
  • 1-[(4-Methylphenyl)amino]cyclohexanecarboxylic acid
Found 1 products.