CymitQuimica logo

CAS 99282-79-8

:

2-[(Carboxymethyl)amino]-4-chlorobenzoic acid

Description:
2-[(Carboxymethyl)amino]-4-chlorobenzoic acid, also known by its CAS number 99282-79-8, is an organic compound characterized by the presence of both a carboxymethyl amino group and a chlorobenzoic acid structure. This compound features a chlorinated aromatic ring, which contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and biochemistry. The carboxymethyl amino group enhances its solubility in water, making it suitable for biological applications. The presence of the carboxylic acid functional group allows for potential interactions with other molecules, such as forming salts or participating in acid-base reactions. Additionally, the chlorinated substituent can influence the compound's electronic properties and reactivity. Overall, this compound is of interest for its potential use in drug development and as a biochemical tool, owing to its unique structural features and functional groups.
Formula:C9H8ClNO4
InChI:InChI=1S/C9H8ClNO4/c10-5-1-2-6(9(14)15)7(3-5)11-4-8(12)13/h1-3,11H,4H2,(H,12,13)(H,14,15)
InChI key:InChIKey=UDXGKLGUAJLLCJ-UHFFFAOYSA-N
SMILES:N(CC(O)=O)C1=C(C(O)=O)C=CC(Cl)=C1
Synonyms:
  • Anthranilic acid, N-(carboxymethyl)-4-chloro-
  • Benzoic acid, 2-[(carboxymethyl)amino]-4-chloro-
  • N-(2-Carboxy-5-chlorophenyl)glycine
  • 2-[(Carboxymethyl)amino]-4-chlorobenzoic acid
  • 2-Carboxymethylamino-4-chlorobenzoic acid
Found 2 products.