CymitQuimica logo

CAS 99295-82-6

:

3-Cyclopentane-L-alanine

Description:
3-Cyclopentane-L-alanine, identified by its CAS number 99295-82-6, is an amino acid derivative characterized by the presence of a cyclopentane ring attached to the L-alanine structure. This compound features a chiral center, which contributes to its stereochemical properties, making it relevant in various biochemical contexts. The cyclopentane moiety can influence the compound's hydrophobicity and steric properties, potentially affecting its interactions with biological macromolecules. As an amino acid, it contains both an amino group (-NH2) and a carboxylic acid group (-COOH), which are typical functional groups found in amino acids, allowing it to participate in peptide bond formation. The unique structure of 3-Cyclopentane-L-alanine may impart specific biological activities or roles in protein structure and function, making it of interest in fields such as medicinal chemistry and biochemistry. Its solubility, stability, and reactivity can vary based on environmental conditions, which are important considerations for its application in research and industry.
Formula:C8H15NO2
InChI:InChI=1S/C8H15NO2/c9-7(8(10)11)5-6-3-1-2-4-6/h6-7H,1-5,9H2,(H,10,11)/t7-/m0/s1
InChI key:KDYAKYRBGLKMAK-ZETCQYMHSA-N
SMILES:C1CCC(C1)C[C@@H](C(=O)O)N
Synonyms:
  • (S)-2-Aminocyclopentanepropanoic acid
  • (S)-3-Cyclopentylalanine
  • L-Cyclopentylalanine
Found 3 products.