CymitQuimica logo

CAS 99328-23-1

:

1,4-Benzenedicarboxylic acid, bis[4-(methoxycarbonyl)phenyl] ester

Description:
1,4-Benzenedicarboxylic acid, bis[4-(methoxycarbonyl)phenyl] ester, commonly known as a type of diester, is an organic compound characterized by its structure, which includes two ester functional groups derived from 1,4-benzenedicarboxylic acid and 4-(methoxycarbonyl)phenol. This compound typically exhibits a crystalline solid form and is soluble in organic solvents such as dichloromethane and acetone, but has limited solubility in water. Its molecular structure contributes to its potential applications in various fields, including materials science and organic synthesis, particularly in the development of polymers and as intermediates in chemical reactions. The presence of methoxycarbonyl groups enhances its reactivity and may influence its thermal and mechanical properties. Additionally, this compound may exhibit interesting optical properties, making it suitable for applications in optoelectronic devices. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if not managed properly.
Formula:C24H18O8
InChI:InChI=1S/C24H18O8/c1-29-21(25)15-7-11-19(12-8-15)31-23(27)17-3-5-18(6-4-17)24(28)32-20-13-9-16(10-14-20)22(26)30-2/h3-14H,1-2H3
InChI key:XLVVPIVANBPSAY-UHFFFAOYSA-N
SMILES:COC(=O)C1=CC=C(C=C1)OC(=O)C2=CC=C(C=C2)C(=O)OC3=CC=C(C=C3)C(=O)OC
Found 5 products.