CymitQuimica logo

CAS 99329-85-8

:

2-Chloro-4-fluoro-5-nitrobenzaldehyde

Description:
2-Chloro-4-fluoro-5-nitrobenzaldehyde is an aromatic compound characterized by the presence of a benzaldehyde functional group, which features a carbonyl group (–CHO) directly attached to a benzene ring. This compound contains three substituents on the benzene ring: a chlorine atom at the 2-position, a fluorine atom at the 4-position, and a nitro group (–NO2) at the 5-position. These substituents contribute to its chemical reactivity and physical properties. The presence of electronegative atoms like chlorine and fluorine can influence the compound's polarity and solubility in various solvents. Additionally, the nitro group is known for its electron-withdrawing properties, which can affect the compound's reactivity in electrophilic aromatic substitution reactions. 2-Chloro-4-fluoro-5-nitrobenzaldehyde is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Safety precautions should be observed when handling this compound, as it may pose health risks due to its reactive nature and potential toxicity.
Formula:C7H3ClFNO3
InChI:InChI=1S/C7H3ClFNO3/c8-5-2-6(9)7(10(12)13)1-4(5)3-11/h1-3H
InChI key:HNOIAPRHNXBCAE-UHFFFAOYSA-N
SMILES:C1=C(C(=CC(=C1[N+](=O)[O-])F)Cl)C=O
Synonyms:
  • Benzaldehyde, 2-Chloro-4-Fluoro-5-Nitro-
Found 4 products.