CAS 99365-23-8

Formula: C36H58O8

InChI: InChI=1S/C36H58O8/c1-20-26(39)27(40)28(41)29(43-20)44-25-10-11-31(4)21(32(25,5)18-37)8-12-33(6)22(31)9-13-36-23-16-30(2,3)14-15-35(23,19-42-36)24(38)17-34(33,36)7/h9,13,20-29,37-41H,8,10-12,14-19H2,1-7H3/t20-,21-,22-,23-,24+,25-,26+,27+,28-,29+,31+,32-,33-,34+,35-,36+/m1/s1

InChI key: WSSVJIGMYVWUJL-LRSKSROMSA-N

SMILES: C[C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2CC[C@]3([C@H]([C@@]2(C)CO)CC[C@@]4([C@@H]3C=C[C@@]56[C@]4(C[C@@H]([C@@]7([C@H]5CC(CC7)(C)C)CO6)O)C)C)C)O)O)O

Prosaikogenin G

CAS: 99365-23-8

Prosaikogenin G is a compound isolated from the roots of Buleurum bicaule Helm (Apiaceae) and id a derivative of Saikosaponin d in the gastrointestinal tract,

Formula: C₃₆H₅₈O₈

Purity: 98.51% - 99.42%

Color and Shape: Solid

Molecular weight: 618.8409

Ref: TM-TN7109

Prosaikogenin G

CAS: 99365-23-8

Prosaikogenin G

Formula: C₃₆H₅₈O₈

Purity: 99%

Molecular weight: 618.84

Ref: 54-BUP00301

Prosaikogenin G

CAS: 99365-23-8

Formula: C₃₆H₅₈O₈

Molecular weight: 618.85

Ref: 7W-GY2847

Prosaikogenin G

CAS: 99365-23-8

Formula: C₃₆H₅₈O₈

Purity: 95%~99%

Molecular weight: 618.852

Ref: BP-BP2117

PROSAIKOGENIN G

CAS: 99365-23-8

Formula: C₃₆H₅₈O₈

Purity: 95%

Molecular weight: 618.8409

Ref: IN-DA01V523

Prosaikogenin G

CAS: 99365-23-8

Prosaikogenin G is a saponin derivative, which is a bioactive compound commonly found in medicinal plants, traditionally used in Eastern medicine. Saponins are naturally occurring glycosides, and they have a wide range of biological activities due to their amphiphilic nature. Prosaikogenin G is specifically sourced from Bupleurum species, a well-known genus in herbal medicine. These compounds have been extensively studied for their anti-inflammatory and immunomodulatory effects.

Formula: C₃₆H₅₈O₈

Purity: Min. 95%

Molecular weight: 618.84 g/mol

Ref: 3D-XP172891