CymitQuimica logo

CAS 99418-18-5

:

2H-Thiopyran-5-carboxylic acid, 3,4-dihydro-, 1,1-dioxide

Description:
2H-Thiopyran-5-carboxylic acid, 3,4-dihydro-, 1,1-dioxide, identified by its CAS number 99418-18-5, is a heterocyclic organic compound featuring a thiopyran ring structure. This compound is characterized by the presence of a carboxylic acid functional group, which contributes to its acidity and potential reactivity in various chemical reactions. The "1,1-dioxide" designation indicates the presence of two oxygen atoms bonded to the sulfur atom in the thiopyran ring, enhancing its polar characteristics and influencing its solubility in polar solvents. The dihydro configuration suggests that the compound has two hydrogen atoms added to the ring, which may affect its stability and reactivity. Typically, such compounds can exhibit biological activity, making them of interest in medicinal chemistry and drug development. The unique structural features of 2H-thiopyran derivatives often lead to diverse applications, including use as intermediates in organic synthesis or as potential therapeutic agents.
Formula:C6H8O4S
InChI:InChI=1S/C6H8O4S/c7-6(8)5-2-1-3-11(9,10)4-5/h4H,1-3H2,(H,7,8)
InChI key:InChIKey=QXWCCUNTWLGBAB-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CS(=O)(=O)CCC1
Synonyms:
  • 1,1-Dioxo-3,4-dihydro-2H-1λ6-thiopyran-5-carboxylic acid
  • 2H-Thiopyran-5-carboxylic acid, 3,4-dihydro-, 1,1-dioxide
Found 1 products.