CymitQuimica logo

CAS 99419-31-5

:

3-methyloxetane-3-carbaldehyde

Description:
3-Methyloxetane-3-carbaldehyde, with the CAS number 99419-31-5, is a chemical compound characterized by its oxetane ring structure, which is a four-membered cyclic ether. This compound features a methyl group and an aldehyde functional group attached to the oxetane ring, contributing to its reactivity and potential applications in organic synthesis. The presence of the aldehyde group indicates that it can participate in various chemical reactions, such as nucleophilic additions and condensation reactions. 3-Methyloxetane-3-carbaldehyde is typically a colorless to pale yellow liquid at room temperature, exhibiting a distinctive odor. Its molecular structure allows for interesting stereochemical properties and reactivity patterns, making it a subject of interest in synthetic organic chemistry. Additionally, due to its unique structure, it may serve as a building block for more complex molecules in pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C5H8O2
InChI:InChI=1S/C5H8O2/c1-5(2-6)3-7-4-5/h2H,3-4H2,1H3
InChI key:DUQGFIKXKISULR-UHFFFAOYSA-N
SMILES:CC1(COC1)C=O
Synonyms:
  • 3-Oxetanecarboxaldehyde, 3-Methyl-
Found 4 products.