CAS 99455-05-7
:6-Bromo-2-methoxyquinoline
Description:
6-Bromo-2-methoxyquinoline is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a bromine atom at the 6-position and a methoxy group at the 2-position contributes to its unique chemical properties. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. It may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer effects, although specific biological activities can vary based on the context of use. The compound is soluble in organic solvents, and its reactivity can be influenced by the substituents on the quinoline ring. As with many halogenated compounds, it is important to handle 6-bromo-2-methoxyquinoline with care, considering potential toxicity and environmental impact. Proper safety protocols should be followed when working with this substance in a laboratory setting.
Formula:C10H8BrNO
InChI:InChI=1S/C10H8BrNO/c1-13-10-5-2-7-6-8(11)3-4-9(7)12-10/h2-6H,1H3
InChI key:KBTKKEMYFUMFSJ-UHFFFAOYSA-N
SMILES:COC1=NC2=C(C=C1)C=C(C=C2)Br
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
6-Bromo-2-methoxyquinoline, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C10H8BrNOPurity:96%Molecular weight:238.086-Bromo-2-methoxyquinoline
CAS:Formula:C10H8BrNOPurity:98%Color and Shape:SolidMolecular weight:238.08066-Bromo-2-methoxyquinoline
CAS:6-Bromo-2-methoxyquinolineFormula:C10H8BrNOPurity:97%Color and Shape:Yellow SolidMolecular weight:238.080626-Bromo-2-methoxyquinoline
CAS:6-Bromo-2-methoxyquinolineFormula:C10H8BrNOPurity:98%Molecular weight:238.086-Bromo-2-methoxyquinoline
CAS:6-Bromo-2-methoxyquinoline is a versatile compound with various applications. It is commonly used as a disinfectant in ceramic compositions and research chemicals. Additionally, it has been found to have potential therapeutic benefits. Studies have shown that 6-Bromo-2-methoxyquinoline exhibits antioxidant properties and can inhibit the production of inflammatory mediators such as arachidonic acid and prostaglandins. Furthermore, it has been found to modulate potassium channels, which play a crucial role in cellular function. This compound also shows promise in the development of copolymers and other materials due to its unique chemical structure. With its wide range of applications, 6-Bromo-2-methoxyquinoline is an essential compound for various industries.Formula:C10H8BrNOPurity:Min. 95%Color and Shape:PowderMolecular weight:238.08 g/mol





