CymitQuimica logo

CAS 99455-13-7

:

5-Bromo-2-chloroquinoline

Description:
5-Bromo-2-chloroquinoline is a heterocyclic organic compound characterized by a quinoline structure, which consists of a fused benzene and pyridine ring. This compound features both bromine and chlorine substituents, specifically at the 5 and 2 positions of the quinoline ring, respectively. The presence of these halogen atoms can significantly influence its chemical reactivity and physical properties, such as solubility and boiling point. Typically, compounds like 5-bromo-2-chloroquinoline exhibit biological activity, making them of interest in medicinal chemistry and drug development. They may also serve as intermediates in the synthesis of more complex molecules. The compound is likely to be a solid at room temperature and may have moderate to low solubility in water, while being more soluble in organic solvents. Its molecular structure allows for potential interactions with biological targets, which is a key consideration in pharmacological applications. Safety data should be consulted for handling and usage, as halogenated compounds can pose environmental and health risks.
Formula:C9H5BrClN
InChI:InChI=1/C9H5BrClN/c10-7-2-1-3-8-6(7)4-5-9(11)12-8/h1-5H
InChI key:NRBXCMIOQORNNX-UHFFFAOYSA-N
SMILES:c1cc(c2ccc(Cl)nc2c1)Br
Synonyms:
  • Quinoline, 5-Bromo-2-Chloro-
  • 2-Chloro-5-Bromoquinoline
Found 4 products.