CymitQuimica logo

CAS 99471-67-7

:

2-ethyl-4-iodoaniline

Description:
2-Ethyl-4-iodoaniline is an organic compound characterized by the presence of an aniline group, which consists of an amino group (-NH2) attached to a benzene ring. In this compound, an ethyl group is substituted at the second position and an iodine atom at the fourth position of the benzene ring. This structure imparts specific physical and chemical properties, including its potential as a precursor in organic synthesis and as a reagent in various chemical reactions. The presence of the iodine atom enhances the compound's reactivity, making it useful in electrophilic substitution reactions. Additionally, the ethyl group contributes to the hydrophobic character of the molecule, influencing its solubility in organic solvents. 2-Ethyl-4-iodoaniline may exhibit moderate toxicity, typical of many aniline derivatives, and should be handled with care in laboratory settings. Its applications can range from pharmaceuticals to agrochemicals, depending on the specific functionalization and reactivity of the compound in synthetic pathways.
Formula:C8H10IN
InChI:InChI=1/C8H10IN/c1-2-6-5-7(9)3-4-8(6)10/h3-5H,2,10H2,1H3
InChI key:PLKZGDYLTZBAEH-UHFFFAOYSA-N
SMILES:CCc1cc(ccc1N)I
Synonyms:
  • Benzenamine, 2-Ethyl-4-Iodo-
  • 2-Ethyl-4-iodoaniline
Found 3 products.