CymitQuimica logo

CAS 99578-58-2

:

3-Thiophenecarboxylic acid, 5-phenyl-

Description:
3-Thiophenecarboxylic acid, 5-phenyl- is an organic compound characterized by the presence of a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features a carboxylic acid functional group (-COOH) at the 3-position of the thiophene ring and a phenyl group attached at the 5-position. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. The compound is likely to exhibit properties typical of carboxylic acids, such as acidity and the ability to form hydrogen bonds. Additionally, the aromatic nature of both the thiophene and phenyl groups may impart stability and influence the compound's solubility and interaction with other molecules. As with many organic compounds, its behavior in chemical reactions can be influenced by the electronic effects of the substituents on the thiophene ring. Overall, 3-Thiophenecarboxylic acid, 5-phenyl- is a compound of interest for its unique structural features and potential utility in synthetic chemistry.
Formula:C11H8O2S
InChI:InChI=1S/C11H8O2S/c12-11(13)9-6-10(14-7-9)8-4-2-1-3-5-8/h1-7H,(H,12,13)
InChI key:UPASVLUUTUDFMY-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C2=CC(=CS2)C(=O)O
Found 4 products.